C19H10Br2N2OS2 — CID 150749355
bis[2-(4-bromophenyl)-1,3-thiazol-5-yl]methanone (PubChem CID 150749355) has the molecular formula C19H10Br2N2OS2 and a molecular weight of 506.24 g/mol. Its IUPAC name is bis[2-(4-bromophenyl)-1,3-thiazol-5-yl]methanone.
| Compound Name | bis[2-(4-bromophenyl)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 150749355 |
| Molecular Formula | C19H10Br2N2OS2 |
| Molecular Weight | 506.24 g/mol |
| Exact Mass | 503.86 |
| IUPAC Name | bis[2-(4-bromophenyl)-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1cnc(-c2ccc(Br)cc2)s1)c1cnc(-c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C19H10Br2N2OS2/c20-13-5-1-11(2-6-13)18-22-9-15(25-18)17(24)16-10-23-19(26-16)12-3-7-14(21)8-4-12/h1-10H |
| InChIKey | JVNKXVOLOURKEG-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.24 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |