C11H7BrClNOS — CID 115568074
1-[2-(3-bromo-4-chlorophenyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 115568074) has the molecular formula C11H7BrClNOS and a molecular weight of 316.61 g/mol. Its IUPAC name is 1-[2-(3-bromo-4-chlorophenyl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(3-bromo-4-chlorophenyl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 115568074 |
| Molecular Formula | C11H7BrClNOS |
| Molecular Weight | 316.61 g/mol |
| Exact Mass | 314.91 |
| IUPAC Name | 1-[2-(3-bromo-4-chlorophenyl)-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1cnc(-c2ccc(Cl)c(Br)c2)s1 |
| InChI | InChI=1S/C11H7BrClNOS/c1-6(15)10-5-14-11(16-10)7-2-3-9(13)8(12)4-7/h2-5H,1H3 |
| InChIKey | DUJZGHLFSFPUQS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |