C15H18N2O2S2 — CID 150283484
5-(4-methylsulfonylphenyl)-2-piperidin-4-yl-1,3-thiazole (PubChem CID 150283484) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 5-(4-methylsulfonylphenyl)-2-piperidin-4-yl-1,3-thiazole.
| Compound Name | 5-(4-methylsulfonylphenyl)-2-piperidin-4-yl-1,3-thiazole |
|---|---|
| PubChem CID | 150283484 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 5-(4-methylsulfonylphenyl)-2-piperidin-4-yl-1,3-thiazole |
| SMILES | CS(=O)(=O)c1ccc(-c2cnc(C3CCNCC3)s2)cc1 |
| InChI | InChI=1S/C15H18N2O2S2/c1-21(18,19)13-4-2-11(3-5-13)14-10-17-15(20-14)12-6-8-16-9-7-12/h2-5,10,12,16H,6-9H2,1H3 |
| InChIKey | GGBRSYIQUFHSPQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |