C14H15NS — CID 174113230
2-cyclopentyl-5-phenyl-1,3-thiazole (PubChem CID 174113230) has the molecular formula C14H15NS and a molecular weight of 229.35 g/mol. Its IUPAC name is 2-cyclopentyl-5-phenyl-1,3-thiazole.
| Compound Name | 2-cyclopentyl-5-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 174113230 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-cyclopentyl-5-phenyl-1,3-thiazole |
| SMILES | c1ccc(-c2cnc(C3CCCC3)s2)cc1 |
| InChI | InChI=1S/C14H15NS/c1-2-6-11(7-3-1)13-10-15-14(16-13)12-8-4-5-9-12/h1-3,6-7,10,12H,4-5,8-9H2 |
| InChIKey | FDMPWNZVNLEBLC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |