C17H22N2S — CID 53271572
1-cyclohexyl-N-[(5-phenyl-1,3-thiazol-2-yl)methyl]methanamine (PubChem CID 53271572) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 1-cyclohexyl-N-[(5-phenyl-1,3-thiazol-2-yl)methyl]methanamine.
| Compound Name | 1-cyclohexyl-N-[(5-phenyl-1,3-thiazol-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 53271572 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-cyclohexyl-N-[(5-phenyl-1,3-thiazol-2-yl)methyl]methanamine |
| SMILES | c1ccc(-c2cnc(CNCC3CCCCC3)s2)cc1 |
| InChI | InChI=1S/C17H22N2S/c1-3-7-14(8-4-1)11-18-13-17-19-12-16(20-17)15-9-5-2-6-10-15/h2,5-6,9-10,12,14,18H,1,3-4,7-8,11,13H2 |
| InChIKey | KHHLPYNSPSYBCS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |