C19H25N3OS — CID 164623440
N-[3-(azepan-1-yl)propyl]-5-phenyl-1,3-thiazole-2-carboxamide (PubChem CID 164623440) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-5-phenyl-1,3-thiazole-2-carboxamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-5-phenyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 164623440 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-5-phenyl-1,3-thiazole-2-carboxamide |
| SMILES | O=C(NCCCN1CCCCCC1)c1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C19H25N3OS/c23-18(20-11-8-14-22-12-6-1-2-7-13-22)19-21-15-17(24-19)16-9-4-3-5-10-16/h3-5,9-10,15H,1-2,6-8,11-14H2,(H,20,23) |
| InChIKey | GTCRUSCFPFCVQB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|