C22H20F3N3OS — CID 66613411
1-[4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3-(2,3,4-trifluorophenyl)urea (PubChem CID 66613411) has the molecular formula C22H20F3N3OS and a molecular weight of 431.48 g/mol. Its IUPAC name is 1-[4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-[4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 66613411 |
| Molecular Formula | C22H20F3N3OS |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 1-[4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3-(2,3,4-trifluorophenyl)urea |
| SMILES | O=C(Nc1ccc(-c2cnc(C3CCCCC3)s2)cc1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C22H20F3N3OS/c23-16-10-11-17(20(25)19(16)24)28-22(29)27-15-8-6-13(7-9-15)18-12-26-21(30-18)14-4-2-1-3-5-14/h6-12,14H,1-5H2,(H2,27,28,29) |
| InChIKey | COPWLJWGHSVAID-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|