C25H25F3N4O3S — CID 66609480
2-methyl-2-[4-[5-[4-[(2,4,5-trifluorophenyl)carbamoylamino]phenyl]-1,3-thiazol-2-yl]piperidin-1-yl]propanoic acid (PubChem CID 66609480) has the molecular formula C25H25F3N4O3S and a molecular weight of 518.56 g/mol. Its IUPAC name is 2-methyl-2-[4-[5-[4-[(2,4,5-trifluorophenyl)carbamoylamino]phenyl]-1,3-thiazol-2-yl]piperidin-1-yl]propanoic acid.
| Compound Name | 2-methyl-2-[4-[5-[4-[(2,4,5-trifluorophenyl)carbamoylamino]phenyl]-1,3-thiazol-2-yl]piperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 66609480 |
| Molecular Formula | C25H25F3N4O3S |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 2-methyl-2-[4-[5-[4-[(2,4,5-trifluorophenyl)carbamoylamino]phenyl]-1,3-thiazol-2-yl]piperidin-1-yl]propanoic acid |
| SMILES | CC(C)(C(=O)O)N1CCC(c2ncc(-c3ccc(NC(=O)Nc4cc(F)c(F)cc4F)cc3)s2)CC1 |
| InChI | InChI=1S/C25H25F3N4O3S/c1-25(2,23(33)34)32-9-7-15(8-10-32)22-29-13-21(36-22)14-3-5-16(6-4-14)30-24(35)31-20-12-18(27)17(26)11-19(20)28/h3-6,11-13,15H,7-10H2,1-2H3,(H,33,34)(H2,30,31,35) |
| InChIKey | DKGBOACDISOBOK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|