C24H24ClN3O2S2 — CID 56929617
methyl 4-[5-[4-[(4-chlorophenyl)carbamothioylamino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylate (PubChem CID 56929617) has the molecular formula C24H24ClN3O2S2 and a molecular weight of 486.06 g/mol. Its IUPAC name is methyl 4-[5-[4-[(4-chlorophenyl)carbamothioylamino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[5-[4-[(4-chlorophenyl)carbamothioylamino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 56929617 |
| Molecular Formula | C24H24ClN3O2S2 |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | methyl 4-[5-[4-[(4-chlorophenyl)carbamothioylamino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(c2ncc(-c3ccc(NC(=S)Nc4ccc(Cl)cc4)cc3)s2)CC1 |
| InChI | InChI=1S/C24H24ClN3O2S2/c1-30-23(29)17-4-2-16(3-5-17)22-26-14-21(32-22)15-6-10-19(11-7-15)27-24(31)28-20-12-8-18(25)9-13-20/h6-14,16-17H,2-5H2,1H3,(H2,27,28,31) |
| InChIKey | CFJQHRBXWYPLOU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|