C18H16ClF3N4OS — CID 66610504
1-[4-[2-(2-aminoethyl)-1,3-thiazol-5-yl]phenyl]-3-(2,4,5-trifluorophenyl)urea;hydrochloride (PubChem CID 66610504) has the molecular formula C18H16ClF3N4OS and a molecular weight of 428.87 g/mol. Its IUPAC name is 1-[4-[2-(2-aminoethyl)-1,3-thiazol-5-yl]phenyl]-3-(2,4,5-trifluorophenyl)urea;hydrochloride.
| Compound Name | 1-[4-[2-(2-aminoethyl)-1,3-thiazol-5-yl]phenyl]-3-(2,4,5-trifluorophenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 66610504 |
| Molecular Formula | C18H16ClF3N4OS |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 1-[4-[2-(2-aminoethyl)-1,3-thiazol-5-yl]phenyl]-3-(2,4,5-trifluorophenyl)urea;hydrochloride |
| SMILES | Cl.NCCc1ncc(-c2ccc(NC(=O)Nc3cc(F)c(F)cc3F)cc2)s1 |
| InChI | InChI=1S/C18H15F3N4OS.ClH/c19-12-7-14(21)15(8-13(12)20)25-18(26)24-11-3-1-10(2-4-11)16-9-23-17(27-16)5-6-22;/h1-4,7-9H,5-6,22H2,(H2,24,25,26);1H |
| InChIKey | LCDZFMIFIDIXGF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|