C18H17FN4O3S2 — CID 87074695
1-[4-[2-[[fluoro(methylsulfonyl)amino]methyl]-1,3-thiazol-5-yl]phenyl]-3-phenylurea (PubChem CID 87074695) has the molecular formula C18H17FN4O3S2 and a molecular weight of 420.49 g/mol. Its IUPAC name is 1-[4-[2-[[fluoro(methylsulfonyl)amino]methyl]-1,3-thiazol-5-yl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[2-[[fluoro(methylsulfonyl)amino]methyl]-1,3-thiazol-5-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 87074695 |
| Molecular Formula | C18H17FN4O3S2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 1-[4-[2-[[fluoro(methylsulfonyl)amino]methyl]-1,3-thiazol-5-yl]phenyl]-3-phenylurea |
| SMILES | CS(=O)(=O)N(F)Cc1ncc(-c2ccc(NC(=O)Nc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C18H17FN4O3S2/c1-28(25,26)23(19)12-17-20-11-16(27-17)13-7-9-15(10-8-13)22-18(24)21-14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H2,21,22,24) |
| InChIKey | WFHBHVYUQNDWMR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|