C22H22FN3O2S2 — CID 56929714
4-[5-[4-[(2-fluorophenyl)carbamothioylamino]phenyl]-1,3-thiazol-2-yl]-2,2-dimethylbutanoic acid (PubChem CID 56929714) has the molecular formula C22H22FN3O2S2 and a molecular weight of 443.57 g/mol. Its IUPAC name is 4-[5-[4-[(2-fluorophenyl)carbamothioylamino]phenyl]-1,3-thiazol-2-yl]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[5-[4-[(2-fluorophenyl)carbamothioylamino]phenyl]-1,3-thiazol-2-yl]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 56929714 |
| Molecular Formula | C22H22FN3O2S2 |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 4-[5-[4-[(2-fluorophenyl)carbamothioylamino]phenyl]-1,3-thiazol-2-yl]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCc1ncc(-c2ccc(NC(=S)Nc3ccccc3F)cc2)s1)C(=O)O |
| InChI | InChI=1S/C22H22FN3O2S2/c1-22(2,20(27)28)12-11-19-24-13-18(30-19)14-7-9-15(10-8-14)25-21(29)26-17-6-4-3-5-16(17)23/h3-10,13H,11-12H2,1-2H3,(H,27,28)(H2,25,26,29) |
| InChIKey | LFUKRTXCPHOKPM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|