C19H16F4N4O2S3 — CID 56929615
1-(2-fluorophenyl)-3-[4-[2-[2-(trifluoromethylsulfonylamino)ethyl]-1,3-thiazol-5-yl]phenyl]thiourea (PubChem CID 56929615) has the molecular formula C19H16F4N4O2S3 and a molecular weight of 504.56 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[4-[2-[2-(trifluoromethylsulfonylamino)ethyl]-1,3-thiazol-5-yl]phenyl]thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-[4-[2-[2-(trifluoromethylsulfonylamino)ethyl]-1,3-thiazol-5-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 56929615 |
| Molecular Formula | C19H16F4N4O2S3 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[4-[2-[2-(trifluoromethylsulfonylamino)ethyl]-1,3-thiazol-5-yl]phenyl]thiourea |
| SMILES | O=S(=O)(NCCc1ncc(-c2ccc(NC(=S)Nc3ccccc3F)cc2)s1)C(F)(F)F |
| InChI | InChI=1S/C19H16F4N4O2S3/c20-14-3-1-2-4-15(14)27-18(30)26-13-7-5-12(6-8-13)16-11-24-17(31-16)9-10-25-32(28,29)19(21,22)23/h1-8,11,25H,9-10H2,(H2,26,27,30) |
| InChIKey | FFBZIMUSNSNLOH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|