C20H24FN3O2S2 — CID 8002769
1-[4-[(2S,6S)-2,6-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-fluorophenyl)thiourea (PubChem CID 8002769) has the molecular formula C20H24FN3O2S2 and a molecular weight of 421.56 g/mol. Its IUPAC name is 1-[4-[(2S,6S)-2,6-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[4-[(2S,6S)-2,6-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 8002769 |
| Molecular Formula | C20H24FN3O2S2 |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 1-[4-[(2S,6S)-2,6-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-fluorophenyl)thiourea |
| SMILES | C[C@H]1CCC[C@H](C)N1S(=O)(=O)c1ccc(NC(=S)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C20H24FN3O2S2/c1-14-6-5-7-15(2)24(14)28(25,26)17-12-10-16(11-13-17)22-20(27)23-19-9-4-3-8-18(19)21/h3-4,8-15H,5-7H2,1-2H3,(H2,22,23,27)/t14-,15-/m0/s1 |
| InChIKey | HGYZJMWWIYHLIJ-GJZGRUSLSA-N |
| XLogP | 4.59 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|