C19H29N3O3S2 — CID 124716332
1-[4-[(2R,6R)-2,6-dimethylpiperidin-1-yl]sulfonylphenyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 124716332) has the molecular formula C19H29N3O3S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 1-[4-[(2R,6R)-2,6-dimethylpiperidin-1-yl]sulfonylphenyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[4-[(2R,6R)-2,6-dimethylpiperidin-1-yl]sulfonylphenyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 124716332 |
| Molecular Formula | C19H29N3O3S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-[4-[(2R,6R)-2,6-dimethylpiperidin-1-yl]sulfonylphenyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | C[C@@H]1CCC[C@@H](C)N1S(=O)(=O)c1ccc(NC(=S)NC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C19H29N3O3S2/c1-14-5-3-6-15(2)22(14)27(23,24)18-10-8-16(9-11-18)21-19(26)20-13-17-7-4-12-25-17/h8-11,14-15,17H,3-7,12-13H2,1-2H3,(H2,20,21,26)/t14-,15-,17-/m1/s1 |
| InChIKey | RWVUBVJREOUNPY-BFYDXBDKSA-N |
| XLogP | 3.10 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|