C18H22FN3O2S2 — CID 5010403
1-[3-(diethylsulfamoyl)-4-methylphenyl]-3-(2-fluorophenyl)thiourea (PubChem CID 5010403) has the molecular formula C18H22FN3O2S2 and a molecular weight of 395.53 g/mol. Its IUPAC name is 1-[3-(diethylsulfamoyl)-4-methylphenyl]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[3-(diethylsulfamoyl)-4-methylphenyl]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 5010403 |
| Molecular Formula | C18H22FN3O2S2 |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-[3-(diethylsulfamoyl)-4-methylphenyl]-3-(2-fluorophenyl)thiourea |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=S)Nc2ccccc2F)ccc1C |
| InChI | InChI=1S/C18H22FN3O2S2/c1-4-22(5-2)26(23,24)17-12-14(11-10-13(17)3)20-18(25)21-16-9-7-6-8-15(16)19/h6-12H,4-5H2,1-3H3,(H2,20,21,25) |
| InChIKey | AWIWBXSTYGAYDK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|