C19H24N2O3S2 — CID 26521121
N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-methylsulfanylbenzamide (PubChem CID 26521121) has the molecular formula C19H24N2O3S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-methylsulfanylbenzamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 26521121 |
| Molecular Formula | C19H24N2O3S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-methylsulfanylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)c2ccccc2SC)ccc1C |
| InChI | InChI=1S/C19H24N2O3S2/c1-5-21(6-2)26(23,24)18-13-15(12-11-14(18)3)20-19(22)16-9-7-8-10-17(16)25-4/h7-13H,5-6H2,1-4H3,(H,20,22) |
| InChIKey | XPWITYPWLVBYBL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |