C22H30N4O3S — CID 46489174
N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-piperidin-1-ylpyridine-3-carboxamide (PubChem CID 46489174) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-piperidin-1-ylpyridine-3-carboxamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-piperidin-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 46489174 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-piperidin-1-ylpyridine-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)c2cccnc2N2CCCCC2)ccc1C |
| InChI | InChI=1S/C22H30N4O3S/c1-4-26(5-2)30(28,29)20-16-18(12-11-17(20)3)24-22(27)19-10-9-13-23-21(19)25-14-7-6-8-15-25/h9-13,16H,4-8,14-15H2,1-3H3,(H,24,27) |
| InChIKey | NSXJOFSDKWXUEP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |