C25H32N4OS — CID 155781458
2-(6-azaspiro[2.5]octan-6-yl)-N-(4-methyl-3-piperidin-1-ylsulfanylphenyl)pyridine-3-carboxamide (PubChem CID 155781458) has the molecular formula C25H32N4OS and a molecular weight of 436.63 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-(4-methyl-3-piperidin-1-ylsulfanylphenyl)pyridine-3-carboxamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-(4-methyl-3-piperidin-1-ylsulfanylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155781458 |
| Molecular Formula | C25H32N4OS |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-(4-methyl-3-piperidin-1-ylsulfanylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cccnc2N2CCC3(CC2)CC3)cc1SN1CCCCC1 |
| InChI | InChI=1S/C25H32N4OS/c1-19-7-8-20(18-22(19)31-29-14-3-2-4-15-29)27-24(30)21-6-5-13-26-23(21)28-16-11-25(9-10-25)12-17-28/h5-8,13,18H,2-4,9-12,14-17H2,1H3,(H,27,30) |
| InChIKey | LLLGGVHYRUDNJU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|