C24H30N4OS — CID 155781177
2-(6-azaspiro[2.5]octan-6-yl)-N-[3-[cyclobutyl(methyl)amino]sulfanylphenyl]pyridine-3-carboxamide (PubChem CID 155781177) has the molecular formula C24H30N4OS and a molecular weight of 422.60 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-[cyclobutyl(methyl)amino]sulfanylphenyl]pyridine-3-carboxamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-[cyclobutyl(methyl)amino]sulfanylphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155781177 |
| Molecular Formula | C24H30N4OS |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-[cyclobutyl(methyl)amino]sulfanylphenyl]pyridine-3-carboxamide |
| SMILES | CN(Sc1cccc(NC(=O)c2cccnc2N2CCC3(CC2)CC3)c1)C1CCC1 |
| InChI | InChI=1S/C24H30N4OS/c1-27(19-6-3-7-19)30-20-8-2-5-18(17-20)26-23(29)21-9-4-14-25-22(21)28-15-12-24(10-11-24)13-16-28/h2,4-5,8-9,14,17,19H,3,6-7,10-13,15-16H2,1H3,(H,26,29) |
| InChIKey | NZEACAXQHJQTGB-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|