C17H19FN4O — CID 84576179
N-(3-fluorophenyl)-2-(4-methylpiperazin-1-yl)pyridine-3-carboxamide (PubChem CID 84576179) has the molecular formula C17H19FN4O and a molecular weight of 314.36 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-(4-methylpiperazin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(3-fluorophenyl)-2-(4-methylpiperazin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 84576179 |
| Molecular Formula | C17H19FN4O |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-(3-fluorophenyl)-2-(4-methylpiperazin-1-yl)pyridine-3-carboxamide |
| SMILES | CN1CCN(c2ncccc2C(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H19FN4O/c1-21-8-10-22(11-9-21)16-15(6-3-7-19-16)17(23)20-14-5-2-4-13(18)12-14/h2-7,12H,8-11H2,1H3,(H,20,23) |
| InChIKey | KYHDZTLUOHBKEN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |