C23H29FN4OS — CID 155781222
2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(tert-butylamino)sulfanylphenyl]-6-fluoropyridine-3-carboxamide (PubChem CID 155781222) has the molecular formula C23H29FN4OS and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(tert-butylamino)sulfanylphenyl]-6-fluoropyridine-3-carboxamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(tert-butylamino)sulfanylphenyl]-6-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 155781222 |
| Molecular Formula | C23H29FN4OS |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(tert-butylamino)sulfanylphenyl]-6-fluoropyridine-3-carboxamide |
| SMILES | CC(C)(C)NSc1cccc(NC(=O)c2ccc(F)nc2N2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C23H29FN4OS/c1-22(2,3)27-30-17-6-4-5-16(15-17)25-21(29)18-7-8-19(24)26-20(18)28-13-11-23(9-10-23)12-14-28/h4-8,15,27H,9-14H2,1-3H3,(H,25,29) |
| InChIKey | HPBBSSRVFJGRLE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|