C24H30FN3O3S — CID 155781265
N-[3-(tert-butylsulfamoyl)phenyl]-6-fluoro-2-spiro[2.5]octan-6-ylpyridine-3-carboxamide (PubChem CID 155781265) has the molecular formula C24H30FN3O3S and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[3-(tert-butylsulfamoyl)phenyl]-6-fluoro-2-spiro[2.5]octan-6-ylpyridine-3-carboxamide.
| Compound Name | N-[3-(tert-butylsulfamoyl)phenyl]-6-fluoro-2-spiro[2.5]octan-6-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 155781265 |
| Molecular Formula | C24H30FN3O3S |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | N-[3-(tert-butylsulfamoyl)phenyl]-6-fluoro-2-spiro[2.5]octan-6-ylpyridine-3-carboxamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cccc(NC(=O)c2ccc(F)nc2C2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C24H30FN3O3S/c1-23(2,3)28-32(30,31)18-6-4-5-17(15-18)26-22(29)19-7-8-20(25)27-21(19)16-9-11-24(12-10-16)13-14-24/h4-8,15-16,28H,9-14H2,1-3H3,(H,26,29) |
| InChIKey | JHAOGHFIZAACHG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|