C27H37N3O2S — CID 155780844
2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(tert-butylamino)sulfanylphenyl]-4-(1-hydroxypropan-2-yl)benzamide (PubChem CID 155780844) has the molecular formula C27H37N3O2S and a molecular weight of 467.68 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(tert-butylamino)sulfanylphenyl]-4-(1-hydroxypropan-2-yl)benzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(tert-butylamino)sulfanylphenyl]-4-(1-hydroxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 155780844 |
| Molecular Formula | C27H37N3O2S |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(tert-butylamino)sulfanylphenyl]-4-(1-hydroxypropan-2-yl)benzamide |
| SMILES | CC(CO)c1ccc(C(=O)Nc2cccc(SNC(C)(C)C)c2)c(N2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C27H37N3O2S/c1-19(18-31)20-8-9-23(24(16-20)30-14-12-27(10-11-27)13-15-30)25(32)28-21-6-5-7-22(17-21)33-29-26(2,3)4/h5-9,16-17,19,29,31H,10-15,18H2,1-4H3,(H,28,32) |
| InChIKey | INWWYQVWJHKQNE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|