About CID 155780788
CID 155780788 (PubChem CID 155780788) has the molecular formula C21H23BN2O
and a molecular weight of 330.24 g/mol.
Molecular Properties
| Compound Name | CID 155780788 |
| PubChem CID | 155780788 |
| Molecular Formula | C21H23BN2O |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)Nc2cccc(C)c2)c(N2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C21H23BN2O/c1-15-3-2-4-17(13-15)23-20(25)18-6-5-16(22)14-19(18)24-11-9-21(7-8-21)10-12-24/h2-6,13-14H,7-12H2,1H3,(H,23,25) |
| InChIKey | SXRFBLDZXUMSRW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155780788 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155780788?
The IUPAC name of CID 155780788 (CID 155780788) is not available.
What is the SMILES notation for CID 155780788?
The canonical SMILES for CID 155780788 is [B]c1ccc(C(=O)Nc2cccc(C)c2)c(N2CCC3(CC2)CC3)c1.
What is the InChIKey of CID 155780788?
The InChIKey is SXRFBLDZXUMSRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23BN2O/c1-15-3-2-4-17(13-15)23-20(25)18-6-5-16(22)14-19(18)24-11-9-21(7-8-21)10-12-24/h2-6,13-14H,7-12H2,1H3,(H,23,25).
What are the key properties of CID 155780788?
CID 155780788 has a molecular weight of 330.24 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155780788 is sourced from PubChem (CID 155780788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).