C21H23BN2O — CID 155780788
CID 155780788 (PubChem CID 155780788) has the molecular formula C21H23BN2O and a molecular weight of 330.24 g/mol.
| Compound Name | CID 155780788 |
|---|---|
| PubChem CID | 155780788 |
| Molecular Formula | C21H23BN2O |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)Nc2cccc(C)c2)c(N2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C21H23BN2O/c1-15-3-2-4-17(13-15)23-20(25)18-6-5-16(22)14-19(18)24-11-9-21(7-8-21)10-12-24/h2-6,13-14H,7-12H2,1H3,(H,23,25) |
| InChIKey | SXRFBLDZXUMSRW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|