C21H25N3O5S2 — CID 155780988
2-(6-azaspiro[2.5]octan-6-yl)-N-(3-methylsulfonylphenyl)-4-sulfamoylbenzamide (PubChem CID 155780988) has the molecular formula C21H25N3O5S2 and a molecular weight of 463.58 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-(3-methylsulfonylphenyl)-4-sulfamoylbenzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-(3-methylsulfonylphenyl)-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 155780988 |
| Molecular Formula | C21H25N3O5S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-(3-methylsulfonylphenyl)-4-sulfamoylbenzamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)c2ccc(S(N)(=O)=O)cc2N2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C21H25N3O5S2/c1-30(26,27)16-4-2-3-15(13-16)23-20(25)18-6-5-17(31(22,28)29)14-19(18)24-11-9-21(7-8-21)10-12-24/h2-6,13-14H,7-12H2,1H3,(H,23,25)(H2,22,28,29) |
| InChIKey | AGISKCCNZDEICI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |