C27H34F2N4O2S — CID 155780872
2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-(2-hydroxyethylsulfanylamino)benzamide (PubChem CID 155780872) has the molecular formula C27H34F2N4O2S and a molecular weight of 516.66 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-(2-hydroxyethylsulfanylamino)benzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-(2-hydroxyethylsulfanylamino)benzamide |
|---|---|
| PubChem CID | 155780872 |
| Molecular Formula | C27H34F2N4O2S |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-(2-hydroxyethylsulfanylamino)benzamide |
| SMILES | O=C(Nc1cccc(N2CCC(F)(F)CC2)c1)c1ccc(NSCCO)cc1N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C27H34F2N4O2S/c28-27(29)10-14-32(15-11-27)22-3-1-2-20(18-22)30-25(35)23-5-4-21(31-36-17-16-34)19-24(23)33-12-8-26(6-7-26)9-13-33/h1-5,18-19,31,34H,6-17H2,(H,30,35) |
| InChIKey | UMWSTRBOVRTIJY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|