C30H40F2N6O2S — CID 170791759
2-(6-azaspiro[2.5]octan-6-yl)-N-[1-(4,4-difluoropiperidin-1-yl)pyrrolo[1,2-c]pyrimidin-3-yl]-4-(2-hydroxyethylsulfanylamino)benzamide;ethane (PubChem CID 170791759) has the molecular formula C30H40F2N6O2S and a molecular weight of 586.75 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[1-(4,4-difluoropiperidin-1-yl)pyrrolo[1,2-c]pyrimidin-3-yl]-4-(2-hydroxyethylsulfanylamino)benzamide;ethane.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[1-(4,4-difluoropiperidin-1-yl)pyrrolo[1,2-c]pyrimidin-3-yl]-4-(2-hydroxyethylsulfanylamino)benzamide;ethane |
|---|---|
| PubChem CID | 170791759 |
| Molecular Formula | C30H40F2N6O2S |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[1-(4,4-difluoropiperidin-1-yl)pyrrolo[1,2-c]pyrimidin-3-yl]-4-(2-hydroxyethylsulfanylamino)benzamide;ethane |
| SMILES | CC.O=C(Nc1cc2cccn2c(N2CCC(F)(F)CC2)n1)c1ccc(NSCCO)cc1N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C28H34F2N6O2S.C2H6/c29-28(30)9-14-35(15-10-28)26-32-24(19-21-2-1-11-36(21)26)31-25(38)22-4-3-20(33-39-17-16-37)18-23(22)34-12-7-27(5-6-27)8-13-34;1-2/h1-4,11,18-19,33,37H,5-10,12-17H2,(H,31,38);1-2H3 |
| InChIKey | FTHGXVGVAMISAY-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 85.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|