C24H28N4O6S2 — CID 174310692
2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-(3-methylsulfonyl-2-oxo-1,3-benzoxazol-5-yl)benzamide (PubChem CID 174310692) has the molecular formula C24H28N4O6S2 and a molecular weight of 532.64 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-(3-methylsulfonyl-2-oxo-1,3-benzoxazol-5-yl)benzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-(3-methylsulfonyl-2-oxo-1,3-benzoxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 174310692 |
| Molecular Formula | C24H28N4O6S2 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-(3-methylsulfonyl-2-oxo-1,3-benzoxazol-5-yl)benzamide |
| SMILES | CS(=O)(=O)n1c(=O)oc2ccc(NC(=O)c3ccc(NSCCO)cc3N3CCC4(CC3)CC4)cc21 |
| InChI | InChI=1S/C24H28N4O6S2/c1-36(32,33)28-20-14-16(3-5-21(20)34-23(28)31)25-22(30)18-4-2-17(26-35-13-12-29)15-19(18)27-10-8-24(6-7-24)9-11-27/h2-5,14-15,26,29H,6-13H2,1H3,(H,25,30) |
| InChIKey | OJIYDWBUOXWSBU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|