C26H34FN5O4S — CID 170179340
4-(6-azaspiro[2.5]octan-6-yl)-N-[4-(fluoromethoxy)-3-morpholin-4-ylphenyl]-6-(2-hydroxyethylsulfanylamino)pyridine-3-carboxamide (PubChem CID 170179340) has the molecular formula C26H34FN5O4S and a molecular weight of 531.65 g/mol. Its IUPAC name is 4-(6-azaspiro[2.5]octan-6-yl)-N-[4-(fluoromethoxy)-3-morpholin-4-ylphenyl]-6-(2-hydroxyethylsulfanylamino)pyridine-3-carboxamide.
| Compound Name | 4-(6-azaspiro[2.5]octan-6-yl)-N-[4-(fluoromethoxy)-3-morpholin-4-ylphenyl]-6-(2-hydroxyethylsulfanylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170179340 |
| Molecular Formula | C26H34FN5O4S |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 4-(6-azaspiro[2.5]octan-6-yl)-N-[4-(fluoromethoxy)-3-morpholin-4-ylphenyl]-6-(2-hydroxyethylsulfanylamino)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OCF)c(N2CCOCC2)c1)c1cnc(NSCCO)cc1N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C26H34FN5O4S/c27-18-36-23-2-1-19(15-22(23)32-9-12-35-13-10-32)29-25(34)20-17-28-24(30-37-14-11-33)16-21(20)31-7-5-26(3-4-26)6-8-31/h1-2,15-17,33H,3-14,18H2,(H,28,30)(H,29,34) |
| InChIKey | AUNKYKTYOIWVNK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|