C28H36F2N4O3S — CID 170178590
2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(fluoromethoxy)-3-(3-fluoro-3-methylpyrrolidin-1-yl)phenyl]-4-(2-hydroxyethylamino)sulfanylbenzamide (PubChem CID 170178590) has the molecular formula C28H36F2N4O3S and a molecular weight of 546.68 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(fluoromethoxy)-3-(3-fluoro-3-methylpyrrolidin-1-yl)phenyl]-4-(2-hydroxyethylamino)sulfanylbenzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(fluoromethoxy)-3-(3-fluoro-3-methylpyrrolidin-1-yl)phenyl]-4-(2-hydroxyethylamino)sulfanylbenzamide |
|---|---|
| PubChem CID | 170178590 |
| Molecular Formula | C28H36F2N4O3S |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(fluoromethoxy)-3-(3-fluoro-3-methylpyrrolidin-1-yl)phenyl]-4-(2-hydroxyethylamino)sulfanylbenzamide |
| SMILES | CC1(F)CCN(c2cc(NC(=O)c3ccc(SNCCO)cc3N3CCC4(CC3)CC4)ccc2OCF)C1 |
| InChI | InChI=1S/C28H36F2N4O3S/c1-27(30)8-12-34(18-27)24-16-20(2-5-25(24)37-19-29)32-26(36)22-4-3-21(38-31-11-15-35)17-23(22)33-13-9-28(6-7-28)10-14-33/h2-5,16-17,31,35H,6-15,18-19H2,1H3,(H,32,36) |
| InChIKey | WXKSZBUAMMTHLQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|