C27H34FN3O4S — CID 170179387
N-[2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylamino)sulfanylphenyl]-3-cyclobutyloxy-4-(fluoromethoxy)benzamide (PubChem CID 170179387) has the molecular formula C27H34FN3O4S and a molecular weight of 515.65 g/mol. Its IUPAC name is N-[2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylamino)sulfanylphenyl]-3-cyclobutyloxy-4-(fluoromethoxy)benzamide.
| Compound Name | N-[2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylamino)sulfanylphenyl]-3-cyclobutyloxy-4-(fluoromethoxy)benzamide |
|---|---|
| PubChem CID | 170179387 |
| Molecular Formula | C27H34FN3O4S |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | N-[2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylamino)sulfanylphenyl]-3-cyclobutyloxy-4-(fluoromethoxy)benzamide |
| SMILES | O=C(Nc1ccc(SNCCO)cc1N1CCC2(CC1)CC2)c1ccc(OCF)c(OC2CCC2)c1 |
| InChI | InChI=1S/C27H34FN3O4S/c28-18-34-24-7-4-19(16-25(24)35-20-2-1-3-20)26(33)30-22-6-5-21(36-29-12-15-32)17-23(22)31-13-10-27(8-9-27)11-14-31/h4-7,16-17,20,29,32H,1-3,8-15,18H2,(H,30,33) |
| InChIKey | PFWXFOAEUQEOBZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|