C26H36N6O4S — CID 170178552
N-[4-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylamino)sulfanyl-3-pyridinyl]-5-methoxy-6-[(2R)-2-methylmorpholin-4-yl]pyridine-2-carboxamide (PubChem CID 170178552) has the molecular formula C26H36N6O4S and a molecular weight of 528.68 g/mol. Its IUPAC name is N-[4-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylamino)sulfanyl-3-pyridinyl]-5-methoxy-6-[(2R)-2-methylmorpholin-4-yl]pyridine-2-carboxamide.
| Compound Name | N-[4-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylamino)sulfanyl-3-pyridinyl]-5-methoxy-6-[(2R)-2-methylmorpholin-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170178552 |
| Molecular Formula | C26H36N6O4S |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | N-[4-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylamino)sulfanyl-3-pyridinyl]-5-methoxy-6-[(2R)-2-methylmorpholin-4-yl]pyridine-2-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2cnc(SNCCO)cc2N2CCC3(CC2)CC3)nc1N1CCO[C@H](C)C1 |
| InChI | InChI=1S/C26H36N6O4S/c1-18-17-32(12-14-36-18)24-22(35-2)4-3-19(29-24)25(34)30-20-16-27-23(37-28-9-13-33)15-21(20)31-10-7-26(5-6-26)8-11-31/h3-4,15-16,18,28,33H,5-14,17H2,1-2H3,(H,30,34)/t18-/m1/s1 |
| InChIKey | MLSYFPFGGYDQSC-GOSISDBHSA-N |
| XLogP | 2.93 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|