C26H35FN6O3S — CID 170178545
N-[4-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylsulfanylamino)-3-pyridinyl]-6-(4-fluoropiperidin-1-yl)-5-methoxypyridine-2-carboxamide (PubChem CID 170178545) has the molecular formula C26H35FN6O3S and a molecular weight of 530.67 g/mol. Its IUPAC name is N-[4-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylsulfanylamino)-3-pyridinyl]-6-(4-fluoropiperidin-1-yl)-5-methoxypyridine-2-carboxamide.
| Compound Name | N-[4-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylsulfanylamino)-3-pyridinyl]-6-(4-fluoropiperidin-1-yl)-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 170178545 |
| Molecular Formula | C26H35FN6O3S |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | N-[4-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylsulfanylamino)-3-pyridinyl]-6-(4-fluoropiperidin-1-yl)-5-methoxypyridine-2-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2cnc(NSCCO)cc2N2CCC3(CC2)CC3)nc1N1CCC(F)CC1 |
| InChI | InChI=1S/C26H35FN6O3S/c1-36-22-3-2-19(29-24(22)33-10-4-18(27)5-11-33)25(35)30-20-17-28-23(31-37-15-14-34)16-21(20)32-12-8-26(6-7-26)9-13-32/h2-3,16-18,34H,4-15H2,1H3,(H,28,31)(H,30,35) |
| InChIKey | OYXSDHWZKURYNL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|