C26H32F2N6O4S — CID 170178892
N-[2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)phenyl]-6-(4,4-difluoropiperidin-1-yl)-5-nitropyridine-2-carboxamide (PubChem CID 170178892) has the molecular formula C26H32F2N6O4S and a molecular weight of 562.64 g/mol. Its IUPAC name is N-[2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)phenyl]-6-(4,4-difluoropiperidin-1-yl)-5-nitropyridine-2-carboxamide.
| Compound Name | N-[2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)phenyl]-6-(4,4-difluoropiperidin-1-yl)-5-nitropyridine-2-carboxamide |
|---|---|
| PubChem CID | 170178892 |
| Molecular Formula | C26H32F2N6O4S |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | N-[2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)phenyl]-6-(4,4-difluoropiperidin-1-yl)-5-nitropyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(NSCCO)cc1N1CCC2(CC1)CC2)c1ccc([N+](=O)[O-])c(N2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C26H32F2N6O4S/c27-26(28)9-13-33(14-10-26)23-21(34(37)38)4-3-20(29-23)24(36)30-19-2-1-18(31-39-16-15-35)17-22(19)32-11-7-25(5-6-25)8-12-32/h1-4,17,31,35H,5-16H2,(H,30,36) |
| InChIKey | QNKTWTHSAGNVER-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 123.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|