C26H34F2N6O2S — CID 171824891
2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-2-yl]-4-(2-hydroxyethylsulfanylamino)benzamide (PubChem CID 171824891) has the molecular formula C26H34F2N6O2S and a molecular weight of 532.66 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-2-yl]-4-(2-hydroxyethylsulfanylamino)benzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-2-yl]-4-(2-hydroxyethylsulfanylamino)benzamide |
|---|---|
| PubChem CID | 171824891 |
| Molecular Formula | C26H34F2N6O2S |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-2-yl]-4-(2-hydroxyethylsulfanylamino)benzamide |
| SMILES | Cc1cc(N2CCC(F)(F)CC2)nc(NC(=O)c2ccc(NSCCO)cc2N2CCC3(CC2)CC3)n1 |
| InChI | InChI=1S/C26H34F2N6O2S/c1-18-16-22(34-12-8-26(27,28)9-13-34)30-24(29-18)31-23(36)20-3-2-19(32-37-15-14-35)17-21(20)33-10-6-25(4-5-25)7-11-33/h2-3,16-17,32,35H,4-15H2,1H3,(H,29,30,31,36) |
| InChIKey | WWBZPGZDKKRPIC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|