C27H28ClF2N5O3S — CID 171824975
ethyl 2-[3-(4-chlorophenyl)-4-[[4-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-2-yl]carbamoyl]anilino]sulfanylacetate (PubChem CID 171824975) has the molecular formula C27H28ClF2N5O3S and a molecular weight of 576.07 g/mol. Its IUPAC name is ethyl 2-[3-(4-chlorophenyl)-4-[[4-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-2-yl]carbamoyl]anilino]sulfanylacetate.
| Compound Name | ethyl 2-[3-(4-chlorophenyl)-4-[[4-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-2-yl]carbamoyl]anilino]sulfanylacetate |
|---|---|
| PubChem CID | 171824975 |
| Molecular Formula | C27H28ClF2N5O3S |
| Molecular Weight | 576.07 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | ethyl 2-[3-(4-chlorophenyl)-4-[[4-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-2-yl]carbamoyl]anilino]sulfanylacetate |
| SMILES | CCOC(=O)CSNc1ccc(C(=O)Nc2nc(C)cc(N3CCC(F)(F)CC3)n2)c(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C27H28ClF2N5O3S/c1-3-38-24(36)16-39-34-20-8-9-21(22(15-20)18-4-6-19(28)7-5-18)25(37)33-26-31-17(2)14-23(32-26)35-12-10-27(29,30)11-13-35/h4-9,14-15,34H,3,10-13,16H2,1-2H3,(H,31,32,33,37) |
| InChIKey | XAZPQMQCUXCRDJ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.07 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|