C18H24N2O4S — CID 170791674
2-(6-azaspiro[2.5]octan-6-yl)-4-[(2-ethoxy-2-oxoethyl)sulfanylamino]benzoic acid (PubChem CID 170791674) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-4-[(2-ethoxy-2-oxoethyl)sulfanylamino]benzoic acid.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-4-[(2-ethoxy-2-oxoethyl)sulfanylamino]benzoic acid |
|---|---|
| PubChem CID | 170791674 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-4-[(2-ethoxy-2-oxoethyl)sulfanylamino]benzoic acid |
| SMILES | CCOC(=O)CSNc1ccc(C(=O)O)c(N2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C18H24N2O4S/c1-2-24-16(21)12-25-19-13-3-4-14(17(22)23)15(11-13)20-9-7-18(5-6-18)8-10-20/h3-4,11,19H,2,5-10,12H2,1H3,(H,22,23) |
| InChIKey | WPEOJZCRSUCUML-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|