C29H36N4O3S — CID 177197243
2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-(2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)benzamide (PubChem CID 177197243) has the molecular formula C29H36N4O3S and a molecular weight of 520.70 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-(2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)benzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-(2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)benzamide |
|---|---|
| PubChem CID | 177197243 |
| Molecular Formula | C29H36N4O3S |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-(2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)C1(CCCCC1)C(=O)N2)c1ccc(NSCCO)cc1N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C29H36N4O3S/c34-16-17-37-32-21-4-6-22(25(19-21)33-14-12-28(10-11-28)13-15-33)26(35)30-20-5-7-24-23(18-20)29(27(36)31-24)8-2-1-3-9-29/h4-7,18-19,32,34H,1-3,8-17H2,(H,30,35)(H,31,36) |
| InChIKey | FCCUKFLWCJMNOH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|