C27H37N5O4S — CID 170178913
2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-[5-methoxy-6-[(2R)-2-methylmorpholin-4-yl]-2-pyridinyl]benzamide (PubChem CID 170178913) has the molecular formula C27H37N5O4S and a molecular weight of 527.69 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-[5-methoxy-6-[(2R)-2-methylmorpholin-4-yl]-2-pyridinyl]benzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-[5-methoxy-6-[(2R)-2-methylmorpholin-4-yl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 170178913 |
| Molecular Formula | C27H37N5O4S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-[5-methoxy-6-[(2R)-2-methylmorpholin-4-yl]-2-pyridinyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NSCCO)cc2N2CCC3(CC2)CC3)nc1N1CCO[C@H](C)C1 |
| InChI | InChI=1S/C27H37N5O4S/c1-19-18-32(13-15-36-19)25-23(35-2)5-6-24(28-25)29-26(34)21-4-3-20(30-37-16-14-33)17-22(21)31-11-9-27(7-8-27)10-12-31/h3-6,17,19,30,33H,7-16,18H2,1-2H3,(H,28,29,34)/t19-/m1/s1 |
| InChIKey | NRLKLVFTDKUACK-LJQANCHMSA-N |
| XLogP | 4.00 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|