C31H41F2N5O4S — CID 170179156
2-[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxy-2-pyridinyl]carbamoyl]anilino]sulfanylethyl 2-methylpropanoate (PubChem CID 170179156) has the molecular formula C31H41F2N5O4S and a molecular weight of 617.76 g/mol. Its IUPAC name is 2-[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxy-2-pyridinyl]carbamoyl]anilino]sulfanylethyl 2-methylpropanoate.
| Compound Name | 2-[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxy-2-pyridinyl]carbamoyl]anilino]sulfanylethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 170179156 |
| Molecular Formula | C31H41F2N5O4S |
| Molecular Weight | 617.76 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | 2-[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxy-2-pyridinyl]carbamoyl]anilino]sulfanylethyl 2-methylpropanoate |
| SMILES | COc1ccc(NC(=O)c2ccc(NSCCOC(=O)C(C)C)cc2N2CCC3(CC2)CC3)nc1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C31H41F2N5O4S/c1-21(2)29(40)42-18-19-43-36-22-4-5-23(24(20-22)37-14-10-30(8-9-30)11-15-37)28(39)35-26-7-6-25(41-3)27(34-26)38-16-12-31(32,33)13-17-38/h4-7,20-21,36H,8-19H2,1-3H3,(H,34,35,39) |
| InChIKey | NUPMWLAJYPWSCY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.76 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|