C25H34N6O2S — CID 171825069
2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-[4-(3-methylpyrrolidin-1-yl)pyrimidin-2-yl]benzamide (PubChem CID 171825069) has the molecular formula C25H34N6O2S and a molecular weight of 482.65 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-[4-(3-methylpyrrolidin-1-yl)pyrimidin-2-yl]benzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-[4-(3-methylpyrrolidin-1-yl)pyrimidin-2-yl]benzamide |
|---|---|
| PubChem CID | 171825069 |
| Molecular Formula | C25H34N6O2S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-[4-(3-methylpyrrolidin-1-yl)pyrimidin-2-yl]benzamide |
| SMILES | CC1CCN(c2ccnc(NC(=O)c3ccc(NSCCO)cc3N3CCC4(CC3)CC4)n2)C1 |
| InChI | InChI=1S/C25H34N6O2S/c1-18-5-11-31(17-18)22-4-10-26-24(27-22)28-23(33)20-3-2-19(29-34-15-14-32)16-21(20)30-12-8-25(6-7-25)9-13-30/h2-4,10,16,18,29,32H,5-9,11-15,17H2,1H3,(H,26,27,28,33) |
| InChIKey | PYJGVRTYAIRTER-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|