C27H34N4O3S — CID 170791666
2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-(2-oxo-1-propan-2-yl-3H-indol-6-yl)benzamide (PubChem CID 170791666) has the molecular formula C27H34N4O3S and a molecular weight of 494.66 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-(2-oxo-1-propan-2-yl-3H-indol-6-yl)benzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-(2-oxo-1-propan-2-yl-3H-indol-6-yl)benzamide |
|---|---|
| PubChem CID | 170791666 |
| Molecular Formula | C27H34N4O3S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfanylamino)-N-(2-oxo-1-propan-2-yl-3H-indol-6-yl)benzamide |
| SMILES | CC(C)N1C(=O)Cc2ccc(NC(=O)c3ccc(NSCCO)cc3N3CCC4(CC3)CC4)cc21 |
| InChI | InChI=1S/C27H34N4O3S/c1-18(2)31-23-16-20(4-3-19(23)15-25(31)33)28-26(34)22-6-5-21(29-35-14-13-32)17-24(22)30-11-9-27(7-8-27)10-12-30/h3-6,16-18,29,32H,7-15H2,1-2H3,(H,28,34) |
| InChIKey | JRVJMAXLSZEBBZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|