C27H33N5O3S — CID 177197209
2-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylsulfanylamino)-N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)pyridine-3-carboxamide (PubChem CID 177197209) has the molecular formula C27H33N5O3S and a molecular weight of 507.66 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylsulfanylamino)-N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)pyridine-3-carboxamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylsulfanylamino)-N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 177197209 |
| Molecular Formula | C27H33N5O3S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylsulfanylamino)-N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C1(CCCC1)C(=O)N2)c1ccc(NSCCO)nc1N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C27H33N5O3S/c33-15-16-36-31-22-6-4-19(23(30-22)32-13-11-26(9-10-26)12-14-32)24(34)28-18-3-5-21-20(17-18)27(25(35)29-21)7-1-2-8-27/h3-6,17,33H,1-2,7-16H2,(H,28,34)(H,29,35)(H,30,31) |
| InChIKey | YTRJFOQLUTVVAI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|