C20H20N2O3 — CID 110405589
2-methoxy-N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)benzamide (PubChem CID 110405589) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-methoxy-N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)benzamide.
| Compound Name | 2-methoxy-N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)benzamide |
|---|---|
| PubChem CID | 110405589 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-methoxy-N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)benzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc2c(c1)C1(CCCC1)C(=O)N2 |
| InChI | InChI=1S/C20H20N2O3/c1-25-17-7-3-2-6-14(17)18(23)21-13-8-9-16-15(12-13)20(19(24)22-16)10-4-5-11-20/h2-3,6-9,12H,4-5,10-11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | CYCNUFFZGWCEAA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |