C21H22N2O4 — CID 110405595
3,4-dimethoxy-N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)benzamide (PubChem CID 110405595) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)benzamide.
| Compound Name | 3,4-dimethoxy-N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)benzamide |
|---|---|
| PubChem CID | 110405595 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 3,4-dimethoxy-N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3c(c2)C2(CCCC2)C(=O)N3)cc1OC |
| InChI | InChI=1S/C21H22N2O4/c1-26-17-8-5-13(11-18(17)27-2)19(24)22-14-6-7-16-15(12-14)21(20(25)23-16)9-3-4-10-21/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | DIGOGIGLEXIVGO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |