C17H22N2O2 — CID 110405476
2-methyl-N-(2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)propanamide (PubChem CID 110405476) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-methyl-N-(2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)propanamide.
| Compound Name | 2-methyl-N-(2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)propanamide |
|---|---|
| PubChem CID | 110405476 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-methyl-N-(2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)propanamide |
| SMILES | CC(C)C(=O)Nc1ccc2c(c1)C1(CCCCC1)C(=O)N2 |
| InChI | InChI=1S/C17H22N2O2/c1-11(2)15(20)18-12-6-7-14-13(10-12)17(16(21)19-14)8-4-3-5-9-17/h6-7,10-11H,3-5,8-9H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | BGLKJGULHICHNF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |