C19H23N3O3 — CID 166410659
N-methyl-N-[2-oxo-2-[(2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)amino]ethyl]prop-2-enamide (PubChem CID 166410659) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-[(2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)amino]ethyl]prop-2-enamide.
| Compound Name | N-methyl-N-[2-oxo-2-[(2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 166410659 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-methyl-N-[2-oxo-2-[(2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)amino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)CC(=O)Nc1ccc2c(c1)C1(CCCCC1)C(=O)N2 |
| InChI | InChI=1S/C19H23N3O3/c1-3-17(24)22(2)12-16(23)20-13-7-8-15-14(11-13)19(18(25)21-15)9-5-4-6-10-19/h3,7-8,11H,1,4-6,9-10,12H2,2H3,(H,20,23)(H,21,25) |
| InChIKey | GLMIVOVMOKXBKY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|