C17H20ClN3O4 — CID 166406546
N-[2-[3-chloro-4-(morpholine-4-carbonyl)anilino]-2-oxoethyl]-N-methylprop-2-enamide (PubChem CID 166406546) has the molecular formula C17H20ClN3O4 and a molecular weight of 365.82 g/mol. Its IUPAC name is N-[2-[3-chloro-4-(morpholine-4-carbonyl)anilino]-2-oxoethyl]-N-methylprop-2-enamide.
| Compound Name | N-[2-[3-chloro-4-(morpholine-4-carbonyl)anilino]-2-oxoethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 166406546 |
| Molecular Formula | C17H20ClN3O4 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-[2-[3-chloro-4-(morpholine-4-carbonyl)anilino]-2-oxoethyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)CC(=O)Nc1ccc(C(=O)N2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C17H20ClN3O4/c1-3-16(23)20(2)11-15(22)19-12-4-5-13(14(18)10-12)17(24)21-6-8-25-9-7-21/h3-5,10H,1,6-9,11H2,2H3,(H,19,22) |
| InChIKey | QGKSHKGYEBORAF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|