C16H22ClN3O3 — CID 119712417
N-[3-chloro-4-(morpholine-4-carbonyl)phenyl]-4-(methylamino)butanamide (PubChem CID 119712417) has the molecular formula C16H22ClN3O3 and a molecular weight of 339.82 g/mol. Its IUPAC name is N-[3-chloro-4-(morpholine-4-carbonyl)phenyl]-4-(methylamino)butanamide.
| Compound Name | N-[3-chloro-4-(morpholine-4-carbonyl)phenyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119712417 |
| Molecular Formula | C16H22ClN3O3 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[3-chloro-4-(morpholine-4-carbonyl)phenyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1ccc(C(=O)N2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C16H22ClN3O3/c1-18-6-2-3-15(21)19-12-4-5-13(14(17)11-12)16(22)20-7-9-23-10-8-20/h4-5,11,18H,2-3,6-10H2,1H3,(H,19,21) |
| InChIKey | GAHUHMRJPBXCEN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|